C13H18N2 — CID 143443266
4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidine-4-carbonitrile (PubChem CID 143443266) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidine-4-carbonitrile.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 143443266 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidine-4-carbonitrile |
| SMILES | C=C/C=C(\C=C/C)C1(C#N)CCNCC1 |
| InChI | InChI=1S/C13H18N2/c1-3-5-12(6-4-2)13(11-14)7-9-15-10-8-13/h3-6,15H,1,7-10H2,2H3/b6-4-,12-5+ |
| InChIKey | YXLZGMOKQDULEU-GLNLJRCCSA-N |
| XLogP | 2.57 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|