C14H21N3O — CID 142167724
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 142167724) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 142167724 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | C=C/C=C(\C=C/C)N1C(=O)NCC12CCNCC2 |
| InChI | InChI=1S/C14H21N3O/c1-3-5-12(6-4-2)17-13(18)16-11-14(17)7-9-15-10-8-14/h3-6,15H,1,7-11H2,2H3,(H,16,18)/b6-4-,12-5+ |
| InChIKey | WWKPWZYBIMKWCP-GLNLJRCCSA-N |
| XLogP | 1.78 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|