C17H38N2 — CID 143232699
ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,4-diazepane (PubChem CID 143232699) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,4-diazepane.
| Compound Name | ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 143232699 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,4-diazepane |
| SMILES | C/C=C\C(=C/C)N1CCCNCC1.CC.CC.CC |
| InChI | InChI=1S/C11H20N2.3C2H6/c1-3-6-11(4-2)13-9-5-7-12-8-10-13;3*1-2/h3-4,6,12H,5,7-10H2,1-2H3;3*1-2H3/b6-3-,11-4+;;; |
| InChIKey | DXCGXIAEWLLSGL-QFBAJAETSA-N |
| XLogP | 4.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|