C10H21N3 — CID 123287600
1-(1,4-diazepan-1-yl)-N-ethylpropan-1-imine (PubChem CID 123287600) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-N-ethylpropan-1-imine.
| Compound Name | 1-(1,4-diazepan-1-yl)-N-ethylpropan-1-imine |
|---|---|
| PubChem CID | 123287600 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-N-ethylpropan-1-imine |
| SMILES | CC/N=C(\CC)N1CCCNCC1 |
| InChI | InChI=1S/C10H21N3/c1-3-10(12-4-2)13-8-5-6-11-7-9-13/h11H,3-9H2,1-2H3/b12-10+ |
| InChIKey | RMNSQBSSTKHOID-ZRDIBKRKSA-N |
| XLogP | 1.11 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|