C10H21ClN2O2 — CID 119415667
1-(1,4-diazepan-1-yl)-2-propoxyethanone;hydrochloride (PubChem CID 119415667) has the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-propoxyethanone;hydrochloride.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-propoxyethanone;hydrochloride |
|---|---|
| PubChem CID | 119415667 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-propoxyethanone;hydrochloride |
| SMILES | CCCOCC(=O)N1CCCNCC1.Cl |
| InChI | InChI=1S/C10H20N2O2.ClH/c1-2-8-14-9-10(13)12-6-3-4-11-5-7-12;/h11H,2-9H2,1H3;1H |
| InChIKey | SJWGFWXLHWOZQR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|