C11H23ClN2O3 — CID 119415045
1-(1,4-diazepan-1-yl)-2-(2-ethoxyethoxy)ethanone;hydrochloride (PubChem CID 119415045) has the molecular formula C11H23ClN2O3 and a molecular weight of 266.77 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-(2-ethoxyethoxy)ethanone;hydrochloride.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-(2-ethoxyethoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119415045 |
| Molecular Formula | C11H23ClN2O3 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-(2-ethoxyethoxy)ethanone;hydrochloride |
| SMILES | CCOCCOCC(=O)N1CCCNCC1.Cl |
| InChI | InChI=1S/C11H22N2O3.ClH/c1-2-15-8-9-16-10-11(14)13-6-3-4-12-5-7-13;/h12H,2-10H2,1H3;1H |
| InChIKey | OQFMNMDEACZQSB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|