C13H24N2O3 — CID 113227408
1-[4-(2-propoxyacetyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 113227408) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-[4-(2-propoxyacetyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 1-[4-(2-propoxyacetyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 113227408 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-[4-(2-propoxyacetyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CCCOCC(=O)N1CCCN(C(=O)CC)CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-3-10-18-11-13(17)15-7-5-6-14(8-9-15)12(16)4-2/h3-11H2,1-2H3 |
| InChIKey | MHXSUDPCTWKSNF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|