C15H26F2N2 — CID 139566338
1-[(2Z,7Z)-2,4-difluoro-7-methylnona-2,7-dien-3-yl]-1,4-diazepane (PubChem CID 139566338) has the molecular formula C15H26F2N2 and a molecular weight of 272.38 g/mol. Its IUPAC name is 1-[(2Z,7Z)-2,4-difluoro-7-methylnona-2,7-dien-3-yl]-1,4-diazepane.
| Compound Name | 1-[(2Z,7Z)-2,4-difluoro-7-methylnona-2,7-dien-3-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 139566338 |
| Molecular Formula | C15H26F2N2 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 1-[(2Z,7Z)-2,4-difluoro-7-methylnona-2,7-dien-3-yl]-1,4-diazepane |
| SMILES | C/C=C(/C)CCC(F)/C(=C(\C)F)N1CCCNCC1 |
| InChI | InChI=1S/C15H26F2N2/c1-4-12(2)6-7-14(17)15(13(3)16)19-10-5-8-18-9-11-19/h4,14,18H,5-11H2,1-3H3/b12-4-,15-13- |
| InChIKey | BMSSQSPWCFGYFQ-LPVCSJLXSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|