C9H17N3O — CID 82407055
1-methyl-1,4,9-triazaspiro[5.5]undecan-3-one (PubChem CID 82407055) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-methyl-1,4,9-triazaspiro[5.5]undecan-3-one.
| Compound Name | 1-methyl-1,4,9-triazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 82407055 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-methyl-1,4,9-triazaspiro[5.5]undecan-3-one |
| SMILES | CN1CC(=O)NCC12CCNCC2 |
| InChI | InChI=1S/C9H17N3O/c1-12-6-8(13)11-7-9(12)2-4-10-5-3-9/h10H,2-7H2,1H3,(H,11,13) |
| InChIKey | UYIMBZVNSQPCPT-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |