C6H11N3O — CID 75531182
5-methyl-2,5,7-triazaspiro[3.4]octan-6-one (PubChem CID 75531182) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one.
| Compound Name | 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one |
|---|---|
| PubChem CID | 75531182 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one |
| SMILES | CN1C(=O)NCC12CNC2 |
| InChI | InChI=1S/C6H11N3O/c1-9-5(10)8-4-6(9)2-7-3-6/h7H,2-4H2,1H3,(H,8,10) |
| InChIKey | VCSSOKBEBXXSDV-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |