C12H19F2N — CID 156749647
3,3-difluoropyrrolidine;(3Z,5Z)-4-methylhepta-1,3,5-triene (PubChem CID 156749647) has the molecular formula C12H19F2N and a molecular weight of 215.29 g/mol. Its IUPAC name is 3,3-difluoropyrrolidine;(3Z,5Z)-4-methylhepta-1,3,5-triene.
| Compound Name | 3,3-difluoropyrrolidine;(3Z,5Z)-4-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 156749647 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 3,3-difluoropyrrolidine;(3Z,5Z)-4-methylhepta-1,3,5-triene |
| SMILES | C=C/C=C(C)\C=C/C.FC1(F)CCNC1 |
| InChI | InChI=1S/C8H12.C4H7F2N/c1-4-6-8(3)7-5-2;5-4(6)1-2-7-3-4/h4-7H,1H2,2-3H3;7H,1-3H2/b7-5-,8-6-; |
| InChIKey | QIZARHWXQZZSHJ-OVDGFJEXSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|