C24H32O2 — CID 142266380
(3Z,5E)-5-[3-[(3E,5E)-6-hydroxyhepta-1,3,5-trien-3-yl]-1-adamantyl]hepta-1,3,5-trien-2-ol (PubChem CID 142266380) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (3Z,5E)-5-[3-[(3E,5E)-6-hydroxyhepta-1,3,5-trien-3-yl]-1-adamantyl]hepta-1,3,5-trien-2-ol.
| Compound Name | (3Z,5E)-5-[3-[(3E,5E)-6-hydroxyhepta-1,3,5-trien-3-yl]-1-adamantyl]hepta-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 142266380 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (3Z,5E)-5-[3-[(3E,5E)-6-hydroxyhepta-1,3,5-trien-3-yl]-1-adamantyl]hepta-1,3,5-trien-2-ol |
| SMILES | C=C/C(=C\C=C(/C)O)C12CC3CC(C1)CC(C(/C=C\C(=C)O)=C/C)(C3)C2 |
| InChI | InChI=1S/C24H32O2/c1-5-21(9-7-17(3)25)23-12-19-11-20(13-23)15-24(14-19,16-23)22(6-2)10-8-18(4)26/h5-10,19-20,25-26H,1,4,11-16H2,2-3H3/b10-8-,17-7+,21-9+,22-6+ |
| InChIKey | POKXYYHVNOKIQT-CNSNDWFUSA-N |
| XLogP | 6.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|