C15H20Cl2 — CID 159352316
1-(5,5-dichloropenta-1,3-dien-3-yl)adamantane (PubChem CID 159352316) has the molecular formula C15H20Cl2 and a molecular weight of 271.23 g/mol. Its IUPAC name is 1-(5,5-dichloropenta-1,3-dien-3-yl)adamantane.
| Compound Name | 1-(5,5-dichloropenta-1,3-dien-3-yl)adamantane |
|---|---|
| PubChem CID | 159352316 |
| Molecular Formula | C15H20Cl2 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-(5,5-dichloropenta-1,3-dien-3-yl)adamantane |
| SMILES | C=CC(=CC(Cl)Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H20Cl2/c1-2-13(6-14(16)17)15-7-10-3-11(8-15)5-12(4-10)9-15/h2,6,10-12,14H,1,3-5,7-9H2 |
| InChIKey | ZPGFHOGAJWBUBR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|