C16H25N — CID 146322771
N-buta-1,3-dien-2-yl-N-ethyladamantan-1-amine (PubChem CID 146322771) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-N-ethyladamantan-1-amine.
| Compound Name | N-buta-1,3-dien-2-yl-N-ethyladamantan-1-amine |
|---|---|
| PubChem CID | 146322771 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-buta-1,3-dien-2-yl-N-ethyladamantan-1-amine |
| SMILES | C=CC(=C)N(CC)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H25N/c1-4-12(3)17(5-2)16-9-13-6-14(10-16)8-15(7-13)11-16/h4,13-15H,1,3,5-11H2,2H3 |
| InChIKey | SKHDBDITANRVEO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|