C14H26N2 — CID 57132734
2-(1-adamantyl)-1,1-diethylhydrazine (PubChem CID 57132734) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 2-(1-adamantyl)-1,1-diethylhydrazine.
| Compound Name | 2-(1-adamantyl)-1,1-diethylhydrazine |
|---|---|
| PubChem CID | 57132734 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 2-(1-adamantyl)-1,1-diethylhydrazine |
| SMILES | CCN(CC)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H26N2/c1-3-16(4-2)15-14-8-11-5-12(9-14)7-13(6-11)10-14/h11-13,15H,3-10H2,1-2H3 |
| InChIKey | HEFROUSJBHBCBA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|