C12H21N — CID 123976762
N-methyltricyclo[4.3.1.13,8]undecan-1-amine (PubChem CID 123976762) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N-methyltricyclo[4.3.1.13,8]undecan-1-amine.
| Compound Name | N-methyltricyclo[4.3.1.13,8]undecan-1-amine |
|---|---|
| PubChem CID | 123976762 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-methyltricyclo[4.3.1.13,8]undecan-1-amine |
| SMILES | CNC12CC3CCC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H21N/c1-13-12-6-9-2-3-10(7-12)5-11(4-9)8-12/h9-11,13H,2-8H2,1H3 |
| InChIKey | ACACVFQQNLZCKZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |