C12H20O — CID 6974562
[(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methanol (PubChem CID 6974562) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is [(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methanol.
| Compound Name | [(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methanol |
|---|---|
| PubChem CID | 6974562 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | [(3S,6S)-1-tricyclo[4.3.1.13,8]undecanyl]methanol |
| SMILES | OCC12CC3C[C@H](CC[C@@H](C3)C1)C2 |
| InChI | InChI=1S/C12H20O/c13-8-12-5-9-1-2-10(6-12)4-11(3-9)7-12/h9-11,13H,1-8H2/t9-,10-,11?,12?/m0/s1 |
| InChIKey | RKLUIOPJNMECGK-JYBOHDQNSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |