About 1-adamantylmethanol;hydrochloride
1-adamantylmethanol;hydrochloride (PubChem CID 141053946) has the molecular formula C11H19ClO
and a molecular weight of 202.72 g/mol. Its IUPAC name is 1-adamantylmethanol;hydrochloride.
Molecular Properties
| Compound Name | 1-adamantylmethanol;hydrochloride |
| PubChem CID | 141053946 |
| Molecular Formula | C11H19ClO |
| Molecular Weight | 202.72 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-adamantylmethanol;hydrochloride |
| SMILES | Cl.OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H18O.ClH/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11;/h8-10,12H,1-7H2;1H |
| InChIKey | MGKFRDDBZIWGDY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-adamantylmethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethanol;hydrochloride?
The IUPAC name of 1-adamantylmethanol;hydrochloride (CID 141053946) is 1-adamantylmethanol;hydrochloride.
What is the SMILES notation for 1-adamantylmethanol;hydrochloride?
The canonical SMILES for 1-adamantylmethanol;hydrochloride is Cl.OCC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantylmethanol;hydrochloride?
The InChIKey is MGKFRDDBZIWGDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O.ClH/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11;/h8-10,12H,1-7H2;1H.
What are the key properties of 1-adamantylmethanol;hydrochloride?
1-adamantylmethanol;hydrochloride has a molecular weight of 202.72 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethanol;hydrochloride is sourced from PubChem (CID 141053946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).