C13H20N2 — CID 158726283
4-isocyano-N-methyltricyclo[4.3.1.13,8]undecan-1-amine (PubChem CID 158726283) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-isocyano-N-methyltricyclo[4.3.1.13,8]undecan-1-amine.
| Compound Name | 4-isocyano-N-methyltricyclo[4.3.1.13,8]undecan-1-amine |
|---|---|
| PubChem CID | 158726283 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4-isocyano-N-methyltricyclo[4.3.1.13,8]undecan-1-amine |
| SMILES | [C-]#[N+]C1CC2CC3CC1CC(NC)(C3)C2 |
| InChI | InChI=1S/C13H20N2/c1-14-12-5-10-3-9-4-11(12)8-13(6-9,7-10)15-2/h9-12,15H,3-8H2,2H3 |
| InChIKey | DDUZCNMIJYQOJD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 16.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|