C13H21NO — CID 11896190
N-[(3S,5R)-4-methyl-1-adamantyl]acetamide (PubChem CID 11896190) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[(3S,5R)-4-methyl-1-adamantyl]acetamide.
| Compound Name | N-[(3S,5R)-4-methyl-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 11896190 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-[(3S,5R)-4-methyl-1-adamantyl]acetamide |
| SMILES | CC(=O)NC12CC3C[C@H](C1)C(C)[C@@H](C3)C2 |
| InChI | InChI=1S/C13H21NO/c1-8-11-3-10-4-12(8)7-13(5-10,6-11)14-9(2)15/h8,10-12H,3-7H2,1-2H3,(H,14,15)/t8?,10?,11-,12+,13? |
| InChIKey | AFIJTHLNSLDBGX-HCPWJBBOSA-N |
| XLogP | 2.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |