C23H30F3N3O2 — CID 59684645
N-[(1S,3R)-5-acetamido-2-adamantyl]-2-methyl-2-[3-(trifluoromethyl)anilino]propanamide (PubChem CID 59684645) has the molecular formula C23H30F3N3O2 and a molecular weight of 437.51 g/mol. Its IUPAC name is N-[(1S,3R)-5-acetamido-2-adamantyl]-2-methyl-2-[3-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-[(1S,3R)-5-acetamido-2-adamantyl]-2-methyl-2-[3-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 59684645 |
| Molecular Formula | C23H30F3N3O2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-[(1S,3R)-5-acetamido-2-adamantyl]-2-methyl-2-[3-(trifluoromethyl)anilino]propanamide |
| SMILES | CC(=O)NC12CC3C[C@H](C1)C(NC(=O)C(C)(C)Nc1cccc(C(F)(F)F)c1)[C@@H](C3)C2 |
| InChI | InChI=1S/C23H30F3N3O2/c1-13(30)28-22-10-14-7-15(11-22)19(16(8-14)12-22)27-20(31)21(2,3)29-18-6-4-5-17(9-18)23(24,25)26/h4-6,9,14-16,19,29H,7-8,10-12H2,1-3H3,(H,27,31)(H,28,30)/t14?,15-,16+,19?,22? |
| InChIKey | BFXACXCPUSUIMO-YMSKBKNJSA-N |
| XLogP | 4.10 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |