C22H28F3N3O2 — CID 66628799
4-[[2-methyl-2-[4-(trifluoromethyl)anilino]propanoyl]amino]adamantane-1-carboxamide (PubChem CID 66628799) has the molecular formula C22H28F3N3O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is 4-[[2-methyl-2-[4-(trifluoromethyl)anilino]propanoyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[2-methyl-2-[4-(trifluoromethyl)anilino]propanoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 66628799 |
| Molecular Formula | C22H28F3N3O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-[[2-methyl-2-[4-(trifluoromethyl)anilino]propanoyl]amino]adamantane-1-carboxamide |
| SMILES | CC(C)(Nc1ccc(C(F)(F)F)cc1)C(=O)NC1C2CC3CC1CC(C(N)=O)(C3)C2 |
| InChI | InChI=1S/C22H28F3N3O2/c1-20(2,28-16-5-3-15(4-6-16)22(23,24)25)19(30)27-17-13-7-12-8-14(17)11-21(9-12,10-13)18(26)29/h3-6,12-14,17,28H,7-11H2,1-2H3,(H2,26,29)(H,27,30) |
| InChIKey | GNVQWHHRPYZNNV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |