C21H29N3O5S — CID 122187902
4-[[2-[(4-hydroxyphenyl)sulfonylamino]-2-methylpropanoyl]amino]adamantane-1-carboxamide (PubChem CID 122187902) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is 4-[[2-[(4-hydroxyphenyl)sulfonylamino]-2-methylpropanoyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[2-[(4-hydroxyphenyl)sulfonylamino]-2-methylpropanoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 122187902 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 4-[[2-[(4-hydroxyphenyl)sulfonylamino]-2-methylpropanoyl]amino]adamantane-1-carboxamide |
| SMILES | CC(C)(NS(=O)(=O)c1ccc(O)cc1)C(=O)NC1C2CC3CC1CC(C(N)=O)(C3)C2 |
| InChI | InChI=1S/C21H29N3O5S/c1-20(2,24-30(28,29)16-5-3-15(25)4-6-16)19(27)23-17-13-7-12-8-14(17)11-21(9-12,10-13)18(22)26/h3-6,12-14,17,24-25H,7-11H2,1-2H3,(H2,22,26)(H,23,27) |
| InChIKey | HBEAIRAUSWQMSP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |