C24H35N3O4S — CID 71248863
4-[[2-methyl-2-[(4-propylphenyl)sulfonylamino]propanoyl]amino]adamantane-1-carboxamide (PubChem CID 71248863) has the molecular formula C24H35N3O4S and a molecular weight of 461.63 g/mol. Its IUPAC name is 4-[[2-methyl-2-[(4-propylphenyl)sulfonylamino]propanoyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[2-methyl-2-[(4-propylphenyl)sulfonylamino]propanoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 71248863 |
| Molecular Formula | C24H35N3O4S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 4-[[2-methyl-2-[(4-propylphenyl)sulfonylamino]propanoyl]amino]adamantane-1-carboxamide |
| SMILES | CCCc1ccc(S(=O)(=O)NC(C)(C)C(=O)NC2C3CC4CC2CC(C(N)=O)(C4)C3)cc1 |
| InChI | InChI=1S/C24H35N3O4S/c1-4-5-15-6-8-19(9-7-15)32(30,31)27-23(2,3)22(29)26-20-17-10-16-11-18(20)14-24(12-16,13-17)21(25)28/h6-9,16-18,20,27H,4-5,10-14H2,1-3H3,(H2,25,28)(H,26,29) |
| InChIKey | DYATWJIKEDKGCL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |