C21H29N3O3 — CID 11581516
4-[[2-(4-aminophenoxy)-2-methylpropanoyl]amino]adamantane-1-carboxamide (PubChem CID 11581516) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 4-[[2-(4-aminophenoxy)-2-methylpropanoyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[2-(4-aminophenoxy)-2-methylpropanoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 11581516 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 4-[[2-(4-aminophenoxy)-2-methylpropanoyl]amino]adamantane-1-carboxamide |
| SMILES | CC(C)(Oc1ccc(N)cc1)C(=O)NC1C2CC3CC1CC(C(N)=O)(C3)C2 |
| InChI | InChI=1S/C21H29N3O3/c1-20(2,27-16-5-3-15(22)4-6-16)19(26)24-17-13-7-12-8-14(17)11-21(9-12,10-13)18(23)25/h3-6,12-14,17H,7-11,22H2,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | ZQXKVJFNCYSFCH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|