C21H27F3N2O2 — CID 59684653
N-[(1S,3R)-5-amino-2-adamantyl]-2-methyl-2-[3-(trifluoromethyl)phenoxy]propanamide (PubChem CID 59684653) has the molecular formula C21H27F3N2O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[(1S,3R)-5-amino-2-adamantyl]-2-methyl-2-[3-(trifluoromethyl)phenoxy]propanamide.
| Compound Name | N-[(1S,3R)-5-amino-2-adamantyl]-2-methyl-2-[3-(trifluoromethyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 59684653 |
| Molecular Formula | C21H27F3N2O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[(1S,3R)-5-amino-2-adamantyl]-2-methyl-2-[3-(trifluoromethyl)phenoxy]propanamide |
| SMILES | CC(C)(Oc1cccc(C(F)(F)F)c1)C(=O)NC1[C@@H]2CC3C[C@H]1CC(N)(C3)C2 |
| InChI | InChI=1S/C21H27F3N2O2/c1-19(2,28-16-5-3-4-15(8-16)21(22,23)24)18(27)26-17-13-6-12-7-14(17)11-20(25,9-12)10-13/h3-5,8,12-14,17H,6-7,9-11,25H2,1-2H3,(H,26,27)/t12?,13-,14+,17?,20? |
| InChIKey | WJNCUVRMWAWOIP-SQBWKFEKSA-N |
| XLogP | 3.88 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |