C25H36N2O4S — CID 158407105
4-[3-methyl-2-oxo-3-[(4-propylphenyl)sulfonylamino]butyl]adamantane-1-carboxamide (PubChem CID 158407105) has the molecular formula C25H36N2O4S and a molecular weight of 460.64 g/mol. Its IUPAC name is 4-[3-methyl-2-oxo-3-[(4-propylphenyl)sulfonylamino]butyl]adamantane-1-carboxamide.
| Compound Name | 4-[3-methyl-2-oxo-3-[(4-propylphenyl)sulfonylamino]butyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 158407105 |
| Molecular Formula | C25H36N2O4S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 4-[3-methyl-2-oxo-3-[(4-propylphenyl)sulfonylamino]butyl]adamantane-1-carboxamide |
| SMILES | CCCc1ccc(S(=O)(=O)NC(C)(C)C(=O)CC2C3CC4CC2CC(C(N)=O)(C4)C3)cc1 |
| InChI | InChI=1S/C25H36N2O4S/c1-4-5-16-6-8-20(9-7-16)32(30,31)27-24(2,3)22(28)12-21-18-10-17-11-19(21)15-25(13-17,14-18)23(26)29/h6-9,17-19,21,27H,4-5,10-15H2,1-3H3,(H2,26,29) |
| InChIKey | JOIBOUJHAZXUFN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |