C22H28F3NO3S — CID 148654526
N-[4-(2-adamantyl)-2-methyl-3-oxobutan-2-yl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 148654526) has the molecular formula C22H28F3NO3S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[4-(2-adamantyl)-2-methyl-3-oxobutan-2-yl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(2-adamantyl)-2-methyl-3-oxobutan-2-yl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 148654526 |
| Molecular Formula | C22H28F3NO3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[4-(2-adamantyl)-2-methyl-3-oxobutan-2-yl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)(NS(=O)(=O)c1ccccc1C(F)(F)F)C(=O)CC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H28F3NO3S/c1-21(2,26-30(28,29)19-6-4-3-5-18(19)22(23,24)25)20(27)12-17-15-8-13-7-14(10-15)11-16(17)9-13/h3-6,13-17,26H,7-12H2,1-2H3 |
| InChIKey | NMOCHBYDGYFORK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |