C11H11F3N2O2S — CID 61126492
N-(2-cyanopropan-2-yl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 61126492) has the molecular formula C11H11F3N2O2S and a molecular weight of 292.28 g/mol. Its IUPAC name is N-(2-cyanopropan-2-yl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-cyanopropan-2-yl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61126492 |
| Molecular Formula | C11H11F3N2O2S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | N-(2-cyanopropan-2-yl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)(C#N)NS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O2S/c1-10(2,7-15)16-19(17,18)9-6-4-3-5-8(9)11(12,13)14/h3-6,16H,1-2H3 |
| InChIKey | FVGODIZFKWNLOV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |