C20H27ClN2O3S — CID 71246706
N-(2-adamantyl)-2-[(2-chlorophenyl)sulfonylamino]-2-methylpropanamide (PubChem CID 71246706) has the molecular formula C20H27ClN2O3S and a molecular weight of 410.97 g/mol. Its IUPAC name is N-(2-adamantyl)-2-[(2-chlorophenyl)sulfonylamino]-2-methylpropanamide.
| Compound Name | N-(2-adamantyl)-2-[(2-chlorophenyl)sulfonylamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 71246706 |
| Molecular Formula | C20H27ClN2O3S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-(2-adamantyl)-2-[(2-chlorophenyl)sulfonylamino]-2-methylpropanamide |
| SMILES | CC(C)(NS(=O)(=O)c1ccccc1Cl)C(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H27ClN2O3S/c1-20(2,23-27(25,26)17-6-4-3-5-16(17)21)19(24)22-18-14-8-12-7-13(10-14)11-15(18)9-12/h3-6,12-15,18,23H,7-11H2,1-2H3,(H,22,24) |
| InChIKey | BXMXQPXRYNWLTE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |