About N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide
N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide (PubChem CID 8990556) has the molecular formula C25H38N2O2
and a molecular weight of 398.59 g/mol. Its IUPAC name is N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide.
Molecular Properties
| Compound Name | N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide |
| PubChem CID | 8990556 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NC1C2CC3CC(C2)CC1C3)C(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C25H38N2O2/c1-25(2,23(28)26-21-17-5-13-3-14(7-17)8-18(21)6-13)24(29)27-22-19-9-15-4-16(11-19)12-20(22)10-15/h13-22H,3-12H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | RIMZPUDFAANTCR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide?
The IUPAC name of N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide (CID 8990556) is N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide.
What is the SMILES notation for N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide?
The canonical SMILES for N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide is CC(C)(C(=O)NC1C2CC3CC(C2)CC1C3)C(=O)NC1C2CC3CC(C2)CC1C3.
What is the InChIKey of N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide?
The InChIKey is RIMZPUDFAANTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H38N2O2/c1-25(2,23(28)26-21-17-5-13-3-14(7-17)8-18(21)6-13)24(29)27-22-19-9-15-4-16(11-19)12-20(22)10-15/h13-22H,3-12H2,1-2H3,(H,26,28)(H,27,29).
What are the key properties of N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide?
N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide has a molecular weight of 398.59 g/mol, XLogP of 3.89, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(2-adamantyl)-2,2-dimethylpropanediamide is sourced from PubChem (CID 8990556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).