C20H26Cl2N2O3S — CID 71246401
N-(2-adamantyl)-2-[(3,4-dichlorophenyl)sulfonylamino]-2-methylpropanamide (PubChem CID 71246401) has the molecular formula C20H26Cl2N2O3S and a molecular weight of 445.41 g/mol. Its IUPAC name is N-(2-adamantyl)-2-[(3,4-dichlorophenyl)sulfonylamino]-2-methylpropanamide.
| Compound Name | N-(2-adamantyl)-2-[(3,4-dichlorophenyl)sulfonylamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 71246401 |
| Molecular Formula | C20H26Cl2N2O3S |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-(2-adamantyl)-2-[(3,4-dichlorophenyl)sulfonylamino]-2-methylpropanamide |
| SMILES | CC(C)(NS(=O)(=O)c1ccc(Cl)c(Cl)c1)C(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H26Cl2N2O3S/c1-20(2,24-28(26,27)15-3-4-16(21)17(22)10-15)19(25)23-18-13-6-11-5-12(8-13)9-14(18)7-11/h3-4,10-14,18,24H,5-9H2,1-2H3,(H,23,25) |
| InChIKey | OAEGCACKOXFKEP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |