C21H29NO — CID 59658227
N-(2-adamantyl)-2-methyl-2-(2-methylphenyl)propanamide (PubChem CID 59658227) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is N-(2-adamantyl)-2-methyl-2-(2-methylphenyl)propanamide.
| Compound Name | N-(2-adamantyl)-2-methyl-2-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 59658227 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | N-(2-adamantyl)-2-methyl-2-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1C(C)(C)C(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H29NO/c1-13-6-4-5-7-18(13)21(2,3)20(23)22-19-16-9-14-8-15(11-16)12-17(19)10-14/h4-7,14-17,19H,8-12H2,1-3H3,(H,22,23) |
| InChIKey | ADKNJIBPDWGKCV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |