C26H39N3O — CID 59658233
N-(2-adamantyl)-2-methyl-2-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]propanamide (PubChem CID 59658233) has the molecular formula C26H39N3O and a molecular weight of 409.62 g/mol. Its IUPAC name is N-(2-adamantyl)-2-methyl-2-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]propanamide.
| Compound Name | N-(2-adamantyl)-2-methyl-2-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 59658233 |
| Molecular Formula | C26H39N3O |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.31 |
| IUPAC Name | N-(2-adamantyl)-2-methyl-2-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]propanamide |
| SMILES | CN1CCN(Cc2cccc(C(C)(C)C(=O)NC3C4CC5CC(C4)CC3C5)c2)CC1 |
| InChI | InChI=1S/C26H39N3O/c1-26(2,23-6-4-5-18(16-23)17-29-9-7-28(3)8-10-29)25(30)27-24-21-12-19-11-20(14-21)15-22(24)13-19/h4-6,16,19-22,24H,7-15,17H2,1-3H3,(H,27,30) |
| InChIKey | ALZDVNZGIICDMM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |