C19H32Cl2N4O — CID 120601515
3-[(4-methylpiperazin-1-yl)methyl]-N-(2-methylpiperidin-4-yl)benzamide;dihydrochloride (PubChem CID 120601515) has the molecular formula C19H32Cl2N4O and a molecular weight of 403.40 g/mol. Its IUPAC name is 3-[(4-methylpiperazin-1-yl)methyl]-N-(2-methylpiperidin-4-yl)benzamide;dihydrochloride.
| Compound Name | 3-[(4-methylpiperazin-1-yl)methyl]-N-(2-methylpiperidin-4-yl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 120601515 |
| Molecular Formula | C19H32Cl2N4O |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3-[(4-methylpiperazin-1-yl)methyl]-N-(2-methylpiperidin-4-yl)benzamide;dihydrochloride |
| SMILES | CC1CC(NC(=O)c2cccc(CN3CCN(C)CC3)c2)CCN1.Cl.Cl |
| InChI | InChI=1S/C19H30N4O.2ClH/c1-15-12-18(6-7-20-15)21-19(24)17-5-3-4-16(13-17)14-23-10-8-22(2)9-11-23;;/h3-5,13,15,18,20H,6-12,14H2,1-2H3,(H,21,24);2*1H |
| InChIKey | GEQLVQZYQYHGTI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |