C16H23N3O3S — CID 119452950
3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-pyrrolidin-3-ylbenzamide (PubChem CID 119452950) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-pyrrolidin-3-ylbenzamide.
| Compound Name | 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-pyrrolidin-3-ylbenzamide |
|---|---|
| PubChem CID | 119452950 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-pyrrolidin-3-ylbenzamide |
| SMILES | O=C(NC1CCNC1)c1cccc(CN2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C16H23N3O3S/c20-16(18-15-4-5-17-11-15)14-3-1-2-13(10-14)12-19-6-8-23(21,22)9-7-19/h1-3,10,15,17H,4-9,11-12H2,(H,18,20) |
| InChIKey | CFMYGIHJLWWBCK-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |