C22H28N4O2 — CID 97279626
3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]oxy-N-[(3S)-pyrrolidin-3-yl]benzamide (PubChem CID 97279626) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]oxy-N-[(3S)-pyrrolidin-3-yl]benzamide.
| Compound Name | 3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]oxy-N-[(3S)-pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 97279626 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 3-[1-(pyridin-4-ylmethyl)piperidin-4-yl]oxy-N-[(3S)-pyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCNC1)c1cccc(OC2CCN(Cc3ccncc3)CC2)c1 |
| InChI | InChI=1S/C22H28N4O2/c27-22(25-19-6-11-24-15-19)18-2-1-3-21(14-18)28-20-7-12-26(13-8-20)16-17-4-9-23-10-5-17/h1-5,9-10,14,19-20,24H,6-8,11-13,15-16H2,(H,25,27)/t19-/m0/s1 |
| InChIKey | UJINAVVNVKJAMR-IBGZPJMESA-N |
| XLogP | 2.22 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |