C31H36IN3O2 — CID 69045875
3-(1-benzylpiperidin-4-yl)oxy-N-[1-[iodo(phenyl)methyl]piperidin-4-yl]benzamide (PubChem CID 69045875) has the molecular formula C31H36IN3O2 and a molecular weight of 609.55 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-4-yl)oxy-N-[1-[iodo(phenyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | 3-(1-benzylpiperidin-4-yl)oxy-N-[1-[iodo(phenyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 69045875 |
| Molecular Formula | C31H36IN3O2 |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 3-(1-benzylpiperidin-4-yl)oxy-N-[1-[iodo(phenyl)methyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(I)c2ccccc2)CC1)c1cccc(OC2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C31H36IN3O2/c32-30(25-10-5-2-6-11-25)35-20-14-27(15-21-35)33-31(36)26-12-7-13-29(22-26)37-28-16-18-34(19-17-28)23-24-8-3-1-4-9-24/h1-13,22,27-28,30H,14-21,23H2,(H,33,36) |
| InChIKey | KGIHHEZGEMUUCT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|