C23H27NO3S — CID 21099728
4-[[2-(1-benzothiophen-3-yl)-2-methylpropanoyl]amino]adamantane-1-carboxylic acid (PubChem CID 21099728) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is 4-[[2-(1-benzothiophen-3-yl)-2-methylpropanoyl]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[2-(1-benzothiophen-3-yl)-2-methylpropanoyl]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 21099728 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 4-[[2-(1-benzothiophen-3-yl)-2-methylpropanoyl]amino]adamantane-1-carboxylic acid |
| SMILES | CC(C)(C(=O)NC1C2CC3CC1CC(C(=O)O)(C3)C2)c1csc2ccccc12 |
| InChI | InChI=1S/C23H27NO3S/c1-22(2,17-12-28-18-6-4-3-5-16(17)18)20(25)24-19-14-7-13-8-15(19)11-23(9-13,10-14)21(26)27/h3-6,12-15,19H,7-11H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | DAJDQCQJJNGACT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |