C26H37NO4 — CID 21099698
4-[[2-methyl-2-(4-pentoxyphenyl)propanoyl]amino]adamantane-1-carboxylic acid (PubChem CID 21099698) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is 4-[[2-methyl-2-(4-pentoxyphenyl)propanoyl]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[2-methyl-2-(4-pentoxyphenyl)propanoyl]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 21099698 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 4-[[2-methyl-2-(4-pentoxyphenyl)propanoyl]amino]adamantane-1-carboxylic acid |
| SMILES | CCCCCOc1ccc(C(C)(C)C(=O)NC2C3CC4CC2CC(C(=O)O)(C4)C3)cc1 |
| InChI | InChI=1S/C26H37NO4/c1-4-5-6-11-31-21-9-7-20(8-10-21)25(2,3)23(28)27-22-18-12-17-13-19(22)16-26(14-17,15-18)24(29)30/h7-10,17-19,22H,4-6,11-16H2,1-3H3,(H,27,28)(H,29,30) |
| InChIKey | RKHRFAMMSUNBGY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|