C24H30F3NO4S — CID 141283189
methyl 4-[[2-methyl-2-[[4-(trifluoromethyl)phenyl]methoxysulfanyl]propanoyl]amino]adamantane-1-carboxylate (PubChem CID 141283189) has the molecular formula C24H30F3NO4S and a molecular weight of 485.57 g/mol. Its IUPAC name is methyl 4-[[2-methyl-2-[[4-(trifluoromethyl)phenyl]methoxysulfanyl]propanoyl]amino]adamantane-1-carboxylate.
| Compound Name | methyl 4-[[2-methyl-2-[[4-(trifluoromethyl)phenyl]methoxysulfanyl]propanoyl]amino]adamantane-1-carboxylate |
|---|---|
| PubChem CID | 141283189 |
| Molecular Formula | C24H30F3NO4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | methyl 4-[[2-methyl-2-[[4-(trifluoromethyl)phenyl]methoxysulfanyl]propanoyl]amino]adamantane-1-carboxylate |
| SMILES | COC(=O)C12CC3CC(C1)C(NC(=O)C(C)(C)SOCc1ccc(C(F)(F)F)cc1)C(C3)C2 |
| InChI | InChI=1S/C24H30F3NO4S/c1-22(2,33-32-13-14-4-6-18(7-5-14)24(25,26)27)20(29)28-19-16-8-15-9-17(19)12-23(10-15,11-16)21(30)31-3/h4-7,15-17,19H,8-13H2,1-3H3,(H,28,29) |
| InChIKey | HJQBBXGMHNLHOH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|