C24H31BrN2O5 — CID 67303150
methyl 4-[(2-bromo-2-methylpropanoyl)-(phenylmethoxycarbonylamino)amino]adamantane-1-carboxylate (PubChem CID 67303150) has the molecular formula C24H31BrN2O5 and a molecular weight of 507.43 g/mol. Its IUPAC name is methyl 4-[(2-bromo-2-methylpropanoyl)-(phenylmethoxycarbonylamino)amino]adamantane-1-carboxylate.
| Compound Name | methyl 4-[(2-bromo-2-methylpropanoyl)-(phenylmethoxycarbonylamino)amino]adamantane-1-carboxylate |
|---|---|
| PubChem CID | 67303150 |
| Molecular Formula | C24H31BrN2O5 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | methyl 4-[(2-bromo-2-methylpropanoyl)-(phenylmethoxycarbonylamino)amino]adamantane-1-carboxylate |
| SMILES | COC(=O)C12CC3CC(C1)C(N(NC(=O)OCc1ccccc1)C(=O)C(C)(C)Br)C(C3)C2 |
| InChI | InChI=1S/C24H31BrN2O5/c1-23(2,25)20(28)27(26-22(30)32-14-15-7-5-4-6-8-15)19-17-9-16-10-18(19)13-24(11-16,12-17)21(29)31-3/h4-8,16-19H,9-14H2,1-3H3,(H,26,30) |
| InChIKey | YKVYTTFGPISPIB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|