C23H31NO4S — CID 87440752
4-[[2-[(4-methoxyphenyl)methoxy]-2-methylpropanethioyl]amino]adamantane-1-carboxylic acid (PubChem CID 87440752) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is 4-[[2-[(4-methoxyphenyl)methoxy]-2-methylpropanethioyl]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[2-[(4-methoxyphenyl)methoxy]-2-methylpropanethioyl]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 87440752 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 4-[[2-[(4-methoxyphenyl)methoxy]-2-methylpropanethioyl]amino]adamantane-1-carboxylic acid |
| SMILES | COc1ccc(COC(C)(C)C(=S)NC2C3CC4CC2CC(C(=O)O)(C4)C3)cc1 |
| InChI | InChI=1S/C23H31NO4S/c1-22(2,28-13-14-4-6-18(27-3)7-5-14)20(29)24-19-16-8-15-9-17(19)12-23(10-15,11-16)21(25)26/h4-7,15-17,19H,8-13H2,1-3H3,(H,24,29)(H,25,26) |
| InChIKey | ZCVWBZAYRVCDOP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|