C24H31NO4 — CID 21099738
4-[[1-(4-methoxyphenyl)cyclopentanecarbonyl]amino]adamantane-1-carboxylic acid (PubChem CID 21099738) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[[1-(4-methoxyphenyl)cyclopentanecarbonyl]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[1-(4-methoxyphenyl)cyclopentanecarbonyl]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 21099738 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 4-[[1-(4-methoxyphenyl)cyclopentanecarbonyl]amino]adamantane-1-carboxylic acid |
| SMILES | COc1ccc(C2(C(=O)NC3C4CC5CC3CC(C(=O)O)(C5)C4)CCCC2)cc1 |
| InChI | InChI=1S/C24H31NO4/c1-29-19-6-4-18(5-7-19)24(8-2-3-9-24)21(26)25-20-16-10-15-11-17(20)14-23(12-15,13-16)22(27)28/h4-7,15-17,20H,2-3,8-14H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | FASYJLAPVZKNHS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |