C24H28F3N3O4 — CID 87440710
4-[[1-(cyanoamino)-2-methyl-2-[[3-(trifluoromethoxy)phenyl]methoxy]propylidene]amino]adamantane-1-carboxylic acid (PubChem CID 87440710) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is 4-[[1-(cyanoamino)-2-methyl-2-[[3-(trifluoromethoxy)phenyl]methoxy]propylidene]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[1-(cyanoamino)-2-methyl-2-[[3-(trifluoromethoxy)phenyl]methoxy]propylidene]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 87440710 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 4-[[1-(cyanoamino)-2-methyl-2-[[3-(trifluoromethoxy)phenyl]methoxy]propylidene]amino]adamantane-1-carboxylic acid |
| SMILES | CC(C)(OCc1cccc(OC(F)(F)F)c1)/C(=N/C1C2CC3CC1CC(C(=O)O)(C3)C2)NC#N |
| InChI | InChI=1S/C24H28F3N3O4/c1-22(2,33-12-14-4-3-5-18(8-14)34-24(25,26)27)20(29-13-28)30-19-16-6-15-7-17(19)11-23(9-15,10-16)21(31)32/h3-5,8,15-17,19H,6-7,9-12H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | FWKMOOHYRBKDPW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|