C22H27N3O2 — CID 91533312
4-[(1-amino-3-cyano-2-methyl-2-phenylpropylidene)amino]adamantane-1-carboxylic acid (PubChem CID 91533312) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 4-[(1-amino-3-cyano-2-methyl-2-phenylpropylidene)amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[(1-amino-3-cyano-2-methyl-2-phenylpropylidene)amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 91533312 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 4-[(1-amino-3-cyano-2-methyl-2-phenylpropylidene)amino]adamantane-1-carboxylic acid |
| SMILES | CC(CC#N)(/C(N)=N/C1C2CC3CC1CC(C(=O)O)(C3)C2)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O2/c1-21(7-8-23,17-5-3-2-4-6-17)19(24)25-18-15-9-14-10-16(18)13-22(11-14,12-15)20(26)27/h2-6,14-16,18H,7,9-13H2,1H3,(H2,24,25)(H,26,27) |
| InChIKey | UUUMSLUQHBKWDI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|