C24H34N8O — CID 87441345
4-[[1-(cyanoamino)-2-methyl-2-(4-pyrazin-2-ylpiperazin-1-yl)propylidene]amino]adamantane-1-carboxamide (PubChem CID 87441345) has the molecular formula C24H34N8O and a molecular weight of 450.59 g/mol. Its IUPAC name is 4-[[1-(cyanoamino)-2-methyl-2-(4-pyrazin-2-ylpiperazin-1-yl)propylidene]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[1-(cyanoamino)-2-methyl-2-(4-pyrazin-2-ylpiperazin-1-yl)propylidene]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 87441345 |
| Molecular Formula | C24H34N8O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 4-[[1-(cyanoamino)-2-methyl-2-(4-pyrazin-2-ylpiperazin-1-yl)propylidene]amino]adamantane-1-carboxamide |
| SMILES | CC(C)(/C(=N/C1C2CC3CC1CC(C(N)=O)(C3)C2)NC#N)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C24H34N8O/c1-23(2,32-7-5-31(6-8-32)19-14-27-3-4-28-19)22(29-15-25)30-20-17-9-16-10-18(20)13-24(11-16,12-17)21(26)33/h3-4,14,16-18,20H,5-13H2,1-2H3,(H2,26,33)(H,29,30) |
| InChIKey | MMDMRHOXNRVOID-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|