C24H30F3N7O2 — CID 87441410
[4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethylidene]amino]-1-adamantyl] carbamate (PubChem CID 87441410) has the molecular formula C24H30F3N7O2 and a molecular weight of 505.55 g/mol. Its IUPAC name is [4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethylidene]amino]-1-adamantyl] carbamate.
| Compound Name | [4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethylidene]amino]-1-adamantyl] carbamate |
|---|---|
| PubChem CID | 87441410 |
| Molecular Formula | C24H30F3N7O2 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | [4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethylidene]amino]-1-adamantyl] carbamate |
| SMILES | N#CN/C(CN1CCN(c2ccc(C(F)(F)F)cn2)CC1)=N\C1C2CC3CC1CC(OC(N)=O)(C3)C2 |
| InChI | InChI=1S/C24H30F3N7O2/c25-24(26,27)18-1-2-20(30-12-18)34-5-3-33(4-6-34)13-19(31-14-28)32-21-16-7-15-8-17(21)11-23(9-15,10-16)36-22(29)35/h1-2,12,15-17,21H,3-11,13H2,(H2,29,35)(H,31,32) |
| InChIKey | SGAPQSGMRGJDJG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|