C27H36F3N7O — CID 87441145
4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pentylidene]amino]adamantane-1-carboxamide (PubChem CID 87441145) has the molecular formula C27H36F3N7O and a molecular weight of 531.63 g/mol. Its IUPAC name is 4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pentylidene]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pentylidene]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 87441145 |
| Molecular Formula | C27H36F3N7O |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | 4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pentylidene]amino]adamantane-1-carboxamide |
| SMILES | CCCC(/C(=N/C1C2CC3CC1CC(C(N)=O)(C3)C2)NC#N)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C27H36F3N7O/c1-2-3-21(36-6-8-37(9-7-36)22-5-4-20(15-33-22)27(28,29)30)24(34-16-31)35-23-18-10-17-11-19(23)14-26(12-17,13-18)25(32)38/h4-5,15,17-19,21,23H,2-3,6-14H2,1H3,(H2,32,38)(H,34,35) |
| InChIKey | YPLWULXMBHHKLO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|