C27H35F3N6O2 — CID 90847342
2-[4-[[1-amino-3-cyano-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propylidene]amino]-1-adamantyl]acetic acid (PubChem CID 90847342) has the molecular formula C27H35F3N6O2 and a molecular weight of 532.61 g/mol. Its IUPAC name is 2-[4-[[1-amino-3-cyano-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propylidene]amino]-1-adamantyl]acetic acid.
| Compound Name | 2-[4-[[1-amino-3-cyano-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propylidene]amino]-1-adamantyl]acetic acid |
|---|---|
| PubChem CID | 90847342 |
| Molecular Formula | C27H35F3N6O2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 2-[4-[[1-amino-3-cyano-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propylidene]amino]-1-adamantyl]acetic acid |
| SMILES | CC(CC#N)(/C(N)=N/C1C2CC3CC1CC(CC(=O)O)(C3)C2)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C27H35F3N6O2/c1-25(4-5-31,36-8-6-35(7-9-36)21-3-2-20(16-33-21)27(28,29)30)24(32)34-23-18-10-17-11-19(23)14-26(12-17,13-18)15-22(37)38/h2-3,16-19,23H,4,6-15H2,1H3,(H2,32,34)(H,37,38) |
| InChIKey | BRHGZAKVRRHYAF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|